Details for 4-Bromophenylboronic acid
4-Bromophenylboronic acid
| 111Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
5467-74-3 |
| EC NO: |
226-779-9 |
| Molecular Formula: |
C6H6BBrO2 |
| Molecular Weight: |
200.8256 |
| Specification: |
|
| InChI: |
InChI=1/C6H6BBrO2/c8-6-3-1-5(2-4-6)7(9)10/h1-4,9-10H |
| Synonyms: |
4-Bromobenzeneboronic acid;dihydroxy-4-bromophenylborane;p-Bromophenylboronic acid;4-BROMOPHENYLBORIC ACID ANHYDRIDE;4-bromo-phenylboronic acid: |
| Molecular Structure: |
 |
if you are sourcing 4-Bromophenylboronic acid from China ,just feel free to inquire
CN
China Suppliers > bjpurechem > 
Search Product