Details for 5-Fluoro-2-methylbenzeneboronic acid
5-Fluoro-2-methylbenzeneboronic acid
| 111Category: |
Organic chemicals and Derivatives/Halogenated derivatives |
|
| CAS NO: |
163517-62-2 |
| EC NO: |
|
| Molecular Formula: |
C7H8BFO2 |
| Molecular Weight: |
153.9466 |
| Specification: |
|
| InChI: |
InChI=1/C7H8BFO2/c1-5-2-3-6(9)4-7(5)8(10)11/h2-4,10-11H,1H3 |
| Synonyms: |
5-Fluoro-2-methylphenylboronic acid~5-Fluoro-o-tolylboronic acid;5-Fluoro-2-methylbenzeneboronic acid; |
| Molecular Structure: |
 |
if you are sourcing 5-Fluoro-2-methylbenzeneboronic acid from China ,just feel free to inquire
CN
China Suppliers > bjpurechem > 
Search Product