Details for Ethylene glycol diacetate

Ethylene glycol diacetate
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
111-55-7 |
EC NO: |
203-881-1 |
Molecular Formula: |
C6H10O4 |
Molecular Weight: |
146.1412 |
Specification: |
|
InChI: |
InChI=1/C6H10O4/c1-4(7)9-6(3)10-5(2)8/h6H,1-3H3 |
Synonyms: |
Ethanediol diacetate;Ethylene diacetate;1,2-Diacetoxyethane;Ethylene Acetate;ethane-1,2-diyl diacetate;ethane-1,2-diyl diacetate - ethane-1,2-diol (1:1);2-acetoxyethyl acetate;1-acetoxyethyl acetate;EGDA;glycol diacetate; |
Molecular Structure: |
 |
if you are sourcing Ethylene glycol diacetate from China ,just feel free to inquire