Ονομασ?α του προ??ντο? |
DL-Dithiothreitol |
Αγγλικ? ?νομα |
DL-Dithiothreitol; Clelands REDUCTACRYL; threo-1,4-Dimercapto-2,3-butanediol; 1,4-dithio-dl-threitol sol.; 1,4-Dithio-DL-threitol; dithiothreitol (dtt) sequencing grade; dithiothreitol molecular biology*reagent; DithiothreitollelandsReagenz; Dithithreitol; DL-Dithothreitol; (2S,3S)-1,4-disulfanylbutane-2,3-diol; DTT; (R,R)-Dithiothreitol; D-threo-1,4-Dimercapto-2,3-butanediol; 2,3-Butanediol, 1,4-dimercapto-, D-threo-; Cleland reagent; D-1,4-Dithiothreitol; D-Dtt; Sputolysin; Threitol, 1,4-dithio-; (R*,R*)-1,4-Dimercapto-2,3-butanediol; 1,4-Dithio-l-threitol; Cleland's reagent; Cleland regent; Clelands reagent; L-DTT; DL-1,4-Dithiothreitol; Dithiothreitol |
MF |
C4H10O2S2 |
Μοριακ? β?ρο? |
154.251 |
InChI |
InChI=1/C4H10O2S2/c1-2(5)3(6)4(7)8/h2-8H,1H3 |
CAS ΟΧΙ |
3483-12-3;27565-41-9;28823-08-7;28823-08-7 |
EINECS |
248-531-9;222-468-7 |
Μοριακ? δομ? |
|
Σημε?ο τ?ξη? |
42-44℃ |
Δε?κτη? δι?θλαση? |
1.576 |
Υδατοδιαλυτ?τητα |
Soluble |
Σ?μβολα επικινδυν?τητα? |
|
Κινδ?νου Κ?δικε? |
|
Περιγραφ? τη? ασφ?λεια? |
S24/25:Avoid contact with skin and eyes.;
|
|