ChemNet > CAS > 52431-30-8 2,5-Dibromo-3,4-dinitrothiophene
52431-30-8 2,5-Dibromo-3,4-dinitrothiophene
Ονομασ?α του προ??ντο? |
2,5-Dibromo-3,4-dinitrothiophene |
Αγγλικ? ?νομα |
2,5-Dibromo-3,4-dinitrothiophene; 2,5-Dibromo-3,4-dinitrthiphene; AKOS 92299; 2,5-DIBROMO-3,4-DINITROTHIOPHENE 98+% |
MF |
C4Br2N2O4S |
Μοριακ? β?ρο? |
331.9268 |
InChI |
InChI=1/C4Br2N2O4S/c5-3-1(7(9)10)2(8(11)12)4(6)13-3 |
CAS ΟΧΙ |
52431-30-8 |
Μοριακ? δομ? |
|
Πυκν?τητα |
2.459g/cm3 |
Σημε?ο βρασμο? |
341.2°C at 760 mmHg |
Δε?κτη? δι?θλαση? |
1.716 |
Σημε?ο αν?φλεξη? |
160.2°C |
Π?εση ατμ?ν |
0.000161mmHg at 25°C |
Σ?μβολα επικινδυν?τητα? |
|
Κινδ?νου Κ?δικε? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφ? τη? ασφ?λεια? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|