ChemNet > CAS > 589-91-3 4-Methylcyclohexanol, mixture of cis and trans
589-91-3 4-Methylcyclohexanol, mixture of cis and trans
Ονομασ?α του προ??ντο? |
4-Methylcyclohexanol, mixture of cis and trans |
Αγγλικ? ?νομα |
4-Methylcyclohexanol, mixture of cis and trans; 4-Methylcyclohexanol (cis+trans); 4-Methylcyclohexanol; trans-4-methylcyclohexanol; Methyl cyclohexanol |
MF |
C7H14O |
Μοριακ? β?ρο? |
114.1855 |
InChI |
InChI=1/C7H14O/c1-6-2-4-7(8)5-3-6/h6-8H,2-5H2,1H3/t6-,7- |
CAS ΟΧΙ |
589-91-3 |
EINECS |
209-664-8 |
Μοριακ? δομ? |
|
Πυκν?τητα |
0.925g/cm3 |
Σημε?ο τ?ξη? |
-41℃ |
Σημε?ο βρασμο? |
170.322°C at 760 mmHg |
Δε?κτη? δι?θλαση? |
1.463 |
Σημε?ο αν?φλεξη? |
70°C |
Υδατοδιαλυτ?τητα |
slightly soluble |
Π?εση ατμ?ν |
0.475mmHg at 25°C |
Σ?μβολα επικινδυν?τητα? |
|
Κινδ?νου Κ?δικε? |
|
Περιγραφ? τη? ασφ?λεια? |
S24/25:;
|
|