10047-28-6 butyl thioglycolate
termék neve |
butyl thioglycolate |
Angol név |
butyl thioglycolate; |
MF |
C6H12O2S |
Molekulat?meg |
148.2233 |
InChI |
InChI=1/C6H12O2S/c1-2-3-4-9-6(8)5-7/h7H,2-5H2,1H3 |
CAS-szám |
10047-28-6 |
EINECS |
233-156-5 |
Molekuláris szerkezete |
|
S?r?ség |
1.088g/cm3 |
Forráspont |
220.125°C at 760 mmHg |
T?résmutató |
1.491 |
Gyulladáspont |
86.929°C |
G?znyomás |
0.024mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Biztonsági Leírás |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|