758-12-3 Acetic acid-d
termék neve |
Acetic acid-d |
Angol név |
Acetic acid-d; Acetic acid-d1; acetate; (O-~2~H)acetic acid |
MF |
C2H3DO2 |
Molekulat?meg |
61.0581 |
InChI |
InChI=1/C2H4O2/c1-2(3)4/h1H3,(H,3,4)/i/hD |
CAS-szám |
758-12-3 |
EINECS |
212-059-1 |
Molekuláris szerkezete |
|
S?r?ség |
1.086g/cm3 |
Olvadáspont |
15-16℃ |
Forráspont |
117.1°C at 760 mmHg |
T?résmutató |
1.375 |
Gyulladáspont |
40°C |
G?znyomás |
13.9mmHg at 25°C |
Veszély szimbólumok |
C:Corrosive;
|
Kockázatot kódok |
R10:Flammable.;
R35:Causes severe burns.;
|
Biztonsági Leírás |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|