ChemNet > CAS > 329-79-3 4-Fluoroacetophenone oxime
329-79-3 4-Fluoroacetophenone oxime
?? ????? |
4-Fluoroacetophenone oxime |
?? ????? |
4-Fluoroacetophenone oxime; Acetophenone, 4'-fluoro-, oxime; 4'-Fluoroacetophenone oxime; BRN 2086063; NSC 154663; Ethanone, 1-(4-fluorophenyl)-, oxime (9CI); 1-(4-fluorophenyl)-N-hydroxyethanimine; (1E)-1-(4-fluorophenyl)ethanone oxime; (1Z)-1-(4-fluorophenyl)ethanone oxime |
????????? ??????? |
C8H8FNO |
???? ???????? |
153.1536 |
InChI |
InChI=1/C8H8FNO/c1-6(10-11)7-2-4-8(9)5-3-7/h2-5,11H,1H3/b10-6- |
???? CAS |
329-79-3 |
???? ???????? |
|
?????? |
1.12g/cm3 |
????? ????? |
72℃ |
????? ????? |
239.8°C at 760 mmHg |
???? ????? |
1.503 |
????? ???? |
98.8°C |
??? ???? |
0.0214mmHg at 25°C |
Hazard ?????? |
|
??????? ???? |
|
?????? ????? |
S24/25:Avoid contact with skin and eyes.;
|
|