ChemNet > CAS > 589-91-3 4-Methylcyclohexanol, mixture of cis and trans
589-91-3 4-Methylcyclohexanol, mixture of cis and trans
?? ????? |
4-Methylcyclohexanol, mixture of cis and trans |
?? ????? |
4-Methylcyclohexanol, mixture of cis and trans; 4-Methylcyclohexanol (cis+trans); 4-Methylcyclohexanol; trans-4-methylcyclohexanol; Methyl cyclohexanol |
????????? ??????? |
C7H14O |
???? ???????? |
114.1855 |
InChI |
InChI=1/C7H14O/c1-6-2-4-7(8)5-3-6/h6-8H,2-5H2,1H3/t6-,7- |
???? CAS |
589-91-3 |
EINECS |
209-664-8 |
???? ???????? |
|
?????? |
0.925g/cm3 |
????? ????? |
-41℃ |
????? ????? |
170.322°C at 760 mmHg |
???? ????? |
1.463 |
????? ???? |
70°C |
?????? ???? |
slightly soluble |
??? ???? |
0.475mmHg at 25°C |
Hazard ?????? |
|
??????? ???? |
|
?????? ????? |
S24/25:;
|
|