ChemNet > CAS > 34590-94-8 dipropylene glycol monomethyl ether, mixture of isomers
34590-94-8 dipropylene glycol monomethyl ether, mixture of isomers
?????? ?? ??? |
dipropylene glycol monomethyl ether, mixture of isomers |
???????? ??? |
dipropylene glycol monomethyl ether, mixture of isomers; Di(propylene glycol) methyl ether; Methoxypropoxypropanol; Dipropylene glycol monomethyl ether; DPM |
????? ???????? |
C7H16O3 |
?????? ??? |
148.2001 |
InChI |
InChI=1/C7H16O3/c1-3-7(8)10-6-4-5-9-2/h7-8H,3-6H2,1-2H3 |
??? ??????? ?????? |
34590-94-8 |
EINECS |
252-104-2 |
????? ?????? |
|
????? |
0.958g/cm3 |
????? ?? ??? |
155.6°C at 760 mmHg |
??????? ??????? |
1.423 |
????? ??????? |
47.9°C |
????? ?? ???? |
1.09mmHg at 25°C |
???? ?????? |
|
???? ?? ??? |
|
??????? ????? |
S23:;
S24/25:;
|
|