4146-43-4 Succinic dihydrazide
??? ????? |
Succinic dihydrazide |
??? ??????? |
Succinic dihydrazide; Butanedioyl dihydrazide; Succinic acid dihydrazide; butanedihydrazide |
????? ???????? |
C4H10N4O2 |
??? ??????? |
146.1478 |
InChI |
InChI=1/C4H10N4O2/c5-7-3(9)1-2-4(10)8-6/h1-2,5-6H2,(H,7,9)(H,8,10) |
????? ?????? |
4146-43-4 |
????? ??????? ??????? |
223-970-9 |
?????? ??????? |
|
????? |
1.284g/cm3 |
???? ??? |
170-168℃ |
???? ????? |
540.2°C at 760 mmHg |
???? ???? |
1.525 |
???? ?????? |
280.5°C |
???? ???? |
9.79E-12mmHg at 25°C |
??? ?????? |
|
????? ??? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
??????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|