ChemNet > CAS > 19788-49-9 Mercaptopropionicacidethylester
19788-49-9 Mercaptopropionicacidethylester
???? |
Mercaptopropionicacidethylester |
?? ?? |
Mercaptopropionicacidethylester; 2-Mercaptopropionic acid ethyl ester; Ethyl thiolactate~2-Mercaptopropionic acid ethyl ester; ethyl 2-sulfanylpropanoate; Ethyl 2-mercaptopropionate |
??? |
C5H10O2S |
??? |
134.1967 |
InChI |
InChI=1/C5H10O2S/c1-3-7-5(6)4(2)8/h4,8H,3H2,1-2H3 |
cas?? |
19788-49-9 |
EC?? |
243-314-5 |
?? ?? |
|
?? |
1.04g/cm3 |
??? |
171.7°C at 760 mmHg |
?? ?? |
1.452 |
??? |
57.4°C |
??? |
1.38mmHg at 25°C |
??? ?? |
|
??? ?? |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
?? ?? |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|