3316-09-4 4-Nitrocatechol
???? |
4-Nitrocatechol |
?? ?? |
4-Nitrocatechol; 4-nitropyrocatechol; 3,4-Dihydroxynitrobenzene; 2-hydroxy-4-nitrophenolate; 4-nitrobenzene-1,2-diol |
??? |
C6H5NO4 |
??? |
155.1082 |
InChI |
InChI=1/C6H5NO4/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,8-9H |
cas?? |
3316-09-4 |
EC?? |
222-009-0 |
?? ?? |
|
?? |
1.58g/cm3 |
?? ? |
173-177℃ |
??? |
358.2°C at 760 mmHg |
?? ?? |
1.667 |
??? |
168.8°C |
??? |
1.25E-05mmHg at 25°C |
??? ?? |
Xi:Irritant;
|
??? ?? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
?? ?? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|