ChemNet > CAS > 25781-92-4 5-Chloro-2-nitrodiphenylamine
25781-92-4 5-Chloro-2-nitrodiphenylamine
produktnavn |
5-Chloro-2-nitrodiphenylamine |
Engelsk navn |
5-Chloro-2-nitrodiphenylamine; 2-nitro-5-chlorodiphenyl amine; 5-chloro-2-nitro-N-phenylaniline |
Molekyl?r Formel |
C12H9ClN2O2 |
Molekylvekt |
248.6651 |
InChI |
InChI=1/C12H9ClN2O2/c13-9-6-7-12(15(16)17)11(8-9)14-10-4-2-1-3-5-10/h1-8,14H |
CAS-nummer |
25781-92-4 |
EINECS |
247-261-9 |
Molecular Structure |
|
Tetthet |
1.387g/cm3 |
Smeltepunkt |
110-114℃ |
Kokepunkt |
370.4°C at 760 mmHg |
Brytningsindeks |
1.671 |
Flammepunktet |
177.8°C |
Damptrykk |
1.11E-05mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|