556-90-1 Pseudothiohydantoin
produktnavn |
Pseudothiohydantoin |
Engelsk navn |
Pseudothiohydantoin; 2-imino-1,3-thiazol-4-one; 2-amino-1,3-thiazol-4(5H)-one; 2-Imino-4-thiazolidinone |
Molekyl?r Formel |
C3H4N2OS |
Molekylvekt |
116.1417 |
InChI |
InChI=1/C3H4N2OS/c4-3-5-2(6)1-7-3/h1H2,(H2,4,5,6) |
CAS-nummer |
556-90-1 |
EINECS |
209-145-6 |
Molecular Structure |
|
Tetthet |
1.78g/cm3 |
Smeltepunkt |
249℃ |
Kokepunkt |
253.5°C at 760 mmHg |
Brytningsindeks |
1.785 |
Flammepunktet |
107.1°C |
Damptrykk |
0.0182mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|