ChemNet > CAS > 589-91-3 4-Methylcyclohexanol, mixture of cis and trans
589-91-3 4-Methylcyclohexanol, mixture of cis and trans
produktnavn |
4-Methylcyclohexanol, mixture of cis and trans |
Engelsk navn |
4-Methylcyclohexanol, mixture of cis and trans; 4-Methylcyclohexanol (cis+trans); 4-Methylcyclohexanol; trans-4-methylcyclohexanol; Methyl cyclohexanol |
Molekyl?r Formel |
C7H14O |
Molekylvekt |
114.1855 |
InChI |
InChI=1/C7H14O/c1-6-2-4-7(8)5-3-6/h6-8H,2-5H2,1H3/t6-,7- |
CAS-nummer |
589-91-3 |
EINECS |
209-664-8 |
Molecular Structure |
|
Tetthet |
0.925g/cm3 |
Smeltepunkt |
-41℃ |
Kokepunkt |
170.322°C at 760 mmHg |
Brytningsindeks |
1.463 |
Flammepunktet |
70°C |
Vannl?selighet |
slightly soluble |
Damptrykk |
0.475mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:;
|
|