ChemNet > CAS > 610-57-1 2,4-Dinitrobenzyl chloride
610-57-1 2,4-Dinitrobenzyl chloride
produktnavn |
2,4-Dinitrobenzyl chloride |
Engelsk navn |
2,4-Dinitrobenzyl chloride; alpha-Chloro-2,4-dinitrotoluene; 4-(Chloromethyl)-1,3-dinitrobenzene; 1-(chloromethyl)-2,4-dinitrobenzene |
Molekyl?r Formel |
C7H5ClN2O4 |
Molekylvekt |
216.5786 |
InChI |
InChI=1/C7H5ClN2O4/c8-4-5-1-2-6(9(11)12)3-7(5)10(13)14/h1-3H,4H2 |
CAS-nummer |
610-57-1 |
EINECS |
210-230-5 |
Molecular Structure |
|
Tetthet |
1.538g/cm3 |
Smeltepunkt |
34-36℃ |
Kokepunkt |
349.8°C at 760 mmHg |
Brytningsindeks |
1.614 |
Flammepunktet |
165.4°C |
Damptrykk |
9.24E-05mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R34:Causes burns.;
R36/37:Irritating to eyes and respiratory system.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|