ChemNet > CAS > 19788-49-9 Mercaptopropionicacidethylester
19788-49-9 Mercaptopropionicacidethylester
Nazwa produktu: |
Mercaptopropionicacidethylester |
Angielska nazwa |
Mercaptopropionicacidethylester; 2-Mercaptopropionic acid ethyl ester; Ethyl thiolactate~2-Mercaptopropionic acid ethyl ester; ethyl 2-sulfanylpropanoate; Ethyl 2-mercaptopropionate |
MF |
C5H10O2S |
Masie cz?steczkowej |
134.1967 |
InChI |
InChI=1/C5H10O2S/c1-3-7-5(6)4(2)8/h4,8H,3H2,1-2H3 |
Nr CAS |
19788-49-9 |
EINECS |
243-314-5 |
Struktury molekularnej |
|
G?sto?? |
1.04g/cm3 |
Temperatura wrzenia |
171.7°C at 760 mmHg |
Wspó?czynnik za?amania |
1.452 |
Temperatura zap?onu |
57.4°C |
Ci?nienie pary |
1.38mmHg at 25°C |
Symbole zagro?enia |
|
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpieczeństwo opis |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|