ChemNet > CAS > 51067-38-0 4-Phenoxyphenyl boronic acid
51067-38-0 4-Phenoxyphenyl boronic acid
Nazwa produktu: |
4-Phenoxyphenyl boronic acid |
Angielska nazwa |
4-Phenoxyphenyl boronic acid; 4-Phenoxybenzene boronic acid;
|
MF |
C12H11BO3 |
Masie cz?steczkowej |
214.0249 |
InChI |
InChI=1/C12H11BO3/c14-13(15)10-6-8-12(9-7-10)16-11-4-2-1-3-5-11/h1-9,14-15H |
Nr CAS |
51067-38-0 |
Struktury molekularnej |
|
G?sto?? |
1.23g/cm3 |
Temperatura topnienia |
141-145℃ |
Temperatura wrzenia |
377°C at 760 mmHg |
Wspó?czynnik za?amania |
1.605 |
Temperatura zap?onu |
181.8°C |
Ci?nienie pary |
2.36E-06mmHg at 25°C |
Symbole zagro?enia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|