ChemNet > CAS > 589-91-3 4-Methylcyclohexanol, mixture of cis and trans
589-91-3 4-Methylcyclohexanol, mixture of cis and trans
Nazwa produktu: |
4-Methylcyclohexanol, mixture of cis and trans |
Angielska nazwa |
4-Methylcyclohexanol, mixture of cis and trans; 4-Methylcyclohexanol (cis+trans); 4-Methylcyclohexanol; trans-4-methylcyclohexanol; Methyl cyclohexanol |
MF |
C7H14O |
Masie cz?steczkowej |
114.1855 |
InChI |
InChI=1/C7H14O/c1-6-2-4-7(8)5-3-6/h6-8H,2-5H2,1H3/t6-,7- |
Nr CAS |
589-91-3 |
EINECS |
209-664-8 |
Struktury molekularnej |
|
G?sto?? |
0.925g/cm3 |
Temperatura topnienia |
-41℃ |
Temperatura wrzenia |
170.322°C at 760 mmHg |
Wspó?czynnik za?amania |
1.463 |
Temperatura zap?onu |
70°C |
Rozpuszczalno?? w wodzie |
slightly soluble |
Ci?nienie pary |
0.475mmHg at 25°C |
Symbole zagro?enia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
S24/25:;
|
|