758-12-3 Acetic acid-d
Nazwa produktu: |
Acetic acid-d |
Angielska nazwa |
Acetic acid-d; Acetic acid-d1; acetate; (O-~2~H)acetic acid |
MF |
C2H3DO2 |
Masie cz?steczkowej |
61.0581 |
InChI |
InChI=1/C2H4O2/c1-2(3)4/h1H3,(H,3,4)/i/hD |
Nr CAS |
758-12-3 |
EINECS |
212-059-1 |
Struktury molekularnej |
|
G?sto?? |
1.086g/cm3 |
Temperatura topnienia |
15-16℃ |
Temperatura wrzenia |
117.1°C at 760 mmHg |
Wspó?czynnik za?amania |
1.375 |
Temperatura zap?onu |
40°C |
Ci?nienie pary |
13.9mmHg at 25°C |
Symbole zagro?enia |
C:Corrosive;
|
Kody ryzyka |
R10:Flammable.;
R35:Causes severe burns.;
|
Bezpieczeństwo opis |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|