9003-20-7 Poly(vinyl acetate)
Nazwa produktu: |
Poly(vinyl acetate) |
Angielska nazwa |
Poly(vinyl acetate); PolyvinylacetateMWca; poly(1-acetoxyethylene); Vinyl Acetate Resin (Low M.Wt.); Vinyl Acetate Latex (Med.Particle Size); Vinyl Acetate Latex (Large Particle Size); Vinyl Acetate Resin (Med.M.Wt.); Vinyl Acetate Resin(High M.Wt.); Polyvinyl Acetate; methyl prop-2-enoate; Polymer vinyl acetate; PVAC |
MF |
C4H6O2 |
Masie cz?steczkowej |
86.0892 |
InChI |
InChI=1/C4H6O2/c1-3-4(5)6-2/h3H,1H2,2H3 |
Nr CAS |
9003-20-7 |
EINECS |
202-500-6 |
Struktury molekularnej |
|
G?sto?? |
0.924g/cm3 |
Temperatura wrzenia |
80.2°C at 760 mmHg |
Wspó?czynnik za?amania |
1.39 |
Temperatura zap?onu |
6.7°C |
Ci?nienie pary |
86.3mmHg at 25°C |
Symbole zagro?enia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|