ChemNet > CAS > 19788-49-9 Mercaptopropionicacidethylester
19788-49-9 Mercaptopropionicacidethylester
??? ?????? |
Mercaptopropionicacidethylester |
????? ??????????? |
Mercaptopropionicacidethylester; 2-Mercaptopropionic acid ethyl ester; Ethyl thiolactate~2-Mercaptopropionic acid ethyl ester; ethyl 2-sulfanylpropanoate; Ethyl 2-mercaptopropionate |
?????? ???????? |
C5H10O2S |
????? ??????? ??????? |
134.1967 |
InChI |
InChI=1/C5H10O2S/c1-3-7-5(6)4(2)8/h4,8H,3H2,1-2H3 |
?????????? ???????? ??????? |
19788-49-9 |
???????? ????????? ??? |
243-314-5 |
???? ?????? |
|
????? |
1.04g/cm3 |
???? ??????? |
171.7°C at 760 mmHg |
????? ???????? |
1.452 |
???? ?????? |
57.4°C |
??? ?????? |
1.38mmHg at 25°C |
?????? ??? ??????? ?????? |
|
??? ????????? |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
???? ????? |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|