3316-09-4 4-Nitrocatechol
??? ?????? |
4-Nitrocatechol |
????? ??????????? |
4-Nitrocatechol; 4-nitropyrocatechol; 3,4-Dihydroxynitrobenzene; 2-hydroxy-4-nitrophenolate; 4-nitrobenzene-1,2-diol |
?????? ???????? |
C6H5NO4 |
????? ??????? ??????? |
155.1082 |
InChI |
InChI=1/C6H5NO4/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,8-9H |
?????????? ???????? ??????? |
3316-09-4 |
???????? ????????? ??? |
222-009-0 |
???? ?????? |
|
????? |
1.58g/cm3 |
???? ???????? |
173-177℃ |
???? ??????? |
358.2°C at 760 mmHg |
????? ???????? |
1.667 |
???? ?????? |
168.8°C |
??? ?????? |
1.25E-05mmHg at 25°C |
?????? ??? ??????? ?????? |
Xi:Irritant;
|
??? ????????? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
???? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|