ChemNet > CAS > 25781-92-4 5-Chloro-2-nitrodiphenylamine
25781-92-4 5-Chloro-2-nitrodiphenylamine
ürün Ad? |
5-Chloro-2-nitrodiphenylamine |
ingilizce ad? |
5-Chloro-2-nitrodiphenylamine; 2-nitro-5-chlorodiphenyl amine; 5-chloro-2-nitro-N-phenylaniline |
Moleküler Formülü |
C12H9ClN2O2 |
Molekül A??rl??? |
248.6651 |
InChI |
InChI=1/C12H9ClN2O2/c13-9-6-7-12(15(16)17)11(8-9)14-10-4-2-1-3-5-10/h1-8,14H |
CAS kay?t numaras? |
25781-92-4 |
EINECS |
247-261-9 |
Moleküler Yap?s? |
|
Yo?unluk |
1.387g/cm3 |
Ergime noktas? |
110-114℃ |
Kaynama noktas? |
370.4°C at 760 mmHg |
K?r?lma indisi |
1.671 |
Alevlenme noktas? |
177.8°C |
Buhar bas?nc? |
1.11E-05mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodlar? |
|
Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|