ChemNet > CAS > 27215-38-9 laurik asit, gliserollü monoester
27215-38-9 laurik asit, gliserollü monoester
ürün Ad? |
laurik asit, gliserollü monoester |
E? anlaml? |
;D odekanoik asit, 1,2,3-propantriol i?eren monoester; Gliseril laurat; AI3-03482; Aldo MLD;Aldo MLD-K-FG; Sithrol GML; Dimodan ML 90; Gliserin monolaurat; Gliserol monolaurat (VAN); Glycerox L 8; Gliseril monolaurat; Grindtek ML 90; Imwitor 312; Laurik asit monogliserit; Lauricidin 802; Lauricidin 812; Lauricidin R; M 300; Monododekanoyl gliserol; Monogliserol laurat; Monolauroilgliserin; Monomullar 90L12; Monomullar L 90; NSC 4837; ?iir M 300; Sunsoft 750; Sunsoft 757; Tegin L 90; UNII-Y98611C087; Laurin, mono- (8CI); dodekanoik asit - propan-1,2,3-triol (1:1);
|
ingilizce ad? |
lauric acid, monoester with glycerol; Dodecanoic acid, monoester with 1,2,3-propanetriol; Glyceryl laurate; AI3-03482; Aldo MLD; Aldo MLD-K-FG; Cithrol GML; Dimodan ML 90; Glycerin monolaurate; Glycerol monolaurate (VAN); Glycerox L 8; Glyceryl monolaurate; Grindtek ML 90; Imwitor 312; Lauric acid monoglyceride; Lauricidin 802; Lauricidin 812; Lauricidin R; M 300; Monododecanoyl glycerol; Monoglycerol laurate; Monolauroylglycerin; Monomuls 90L12; Monomuls L 90; NSC 4837; Poem M 300; Sunsoft 750; Sunsoft 757; Tegin L 90; UNII-Y98611C087; Laurin, mono- (8CI); dodecanoic acid - propane-1,2,3-triol (1:1) |
Moleküler Formülü |
C15H32O5 |
Molekül A??rl??? |
292.4116 |
InChI |
InChI=1/C12H24O2.C3H8O3/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;4-1-3(6)2-5/h2-11H2,1H3,(H,13,14);3-6H,1-2H2 |
CAS kay?t numaras? |
27215-38-9 |
EINECS |
248-337-4 |
Moleküler Yap?s? |
|
Kaynama noktas? |
296.1°C at 760 mmHg |
Alevlenme noktas? |
134.1°C |
Buhar bas?nc? |
0.000661mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodlar? |
|
Güvenlik A??klamas? |
|
|