ChemNet > CAS > 69604-00-8 Ethyl 5-nitrobenzofuran-2-carboxylate
69604-00-8 Ethyl 5-nitrobenzofuran-2-carboxylate
ürün Ad? |
Ethyl 5-nitrobenzofuran-2-carboxylate |
ingilizce ad? |
Ethyl 5-nitrobenzofuran-2-carboxylate; 5-Nitrobenzo[b]furan-2-carboxylic acid ethyl ester; 5-nitro-benzofuran-2-carboxylic acid ethyl ester; Vilazodone Intermediate 7; Ethyl 5-nitrobenzo[b]furan-2-carboxylate |
Moleküler Formülü |
C11H9NO5 |
Molekül A??rl??? |
235.1929 |
InChI |
InChI=1/C11H9NO5/c1-2-16-11(13)10-6-7-5-8(12(14)15)3-4-9(7)17-10/h3-6H,2H2,1H3 |
CAS kay?t numaras? |
69604-00-8 |
Moleküler Yap?s? |
|
Yo?unluk |
1.362g/cm3 |
Ergime noktas? |
150℃ |
Kaynama noktas? |
359.7°C at 760 mmHg |
K?r?lma indisi |
1.603 |
Alevlenme noktas? |
171.3°C |
Buhar bas?nc? |
2.34E-05mmHg at 25°C |
Tehlike Sembolleri |
|
Risk Kodlar? |
|
Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|